About sodium;hydride;methylsulfinylmethanol
sodium;hydride;methylsulfinylmethanol (PubChem CID 173447451) has the molecular formula C2H7NaO2S
and a molecular weight of 118.13 g/mol. Its IUPAC name is sodium;hydride;methylsulfinylmethanol.
Molecular Properties
| Compound Name | sodium;hydride;methylsulfinylmethanol |
| PubChem CID | 173447451 |
| Molecular Formula | C2H7NaO2S |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.01 |
| IUPAC Name | sodium;hydride;methylsulfinylmethanol |
| SMILES | CS(=O)CO.[H-].[Na+] |
| InChI | InChI=1S/C2H6O2S.Na.H/c1-5(4)2-3;;/h3H,2H2,1H3;;/q;+1;-1 |
| InChIKey | IRRBLMFZCSURLC-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;methylsulfinylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;methylsulfinylmethanol?
The IUPAC name of sodium;hydride;methylsulfinylmethanol (CID 173447451) is sodium;hydride;methylsulfinylmethanol.
What is the SMILES notation for sodium;hydride;methylsulfinylmethanol?
The canonical SMILES for sodium;hydride;methylsulfinylmethanol is CS(=O)CO.[H-].[Na+].
What is the InChIKey of sodium;hydride;methylsulfinylmethanol?
The InChIKey is IRRBLMFZCSURLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O2S.Na.H/c1-5(4)2-3;;/h3H,2H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;methylsulfinylmethanol?
sodium;hydride;methylsulfinylmethanol has a molecular weight of 118.13 g/mol, XLogP of -3.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methylsulfinylmethanol is sourced from PubChem (CID 173447451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).