About CID 173053941
CID 173053941 (PubChem CID 173053941) has the molecular formula C2H5BOS
and a molecular weight of 87.94 g/mol.
Molecular Properties
| Compound Name | CID 173053941 |
| PubChem CID | 173053941 |
| Molecular Formula | C2H5BOS |
| Molecular Weight | 87.94 g/mol |
| Exact Mass | 88.02 |
| IUPAC Name | — |
| SMILES | [B]CS(C)=O |
| InChI | InChI=1S/C2H5BOS/c1-5(4)2-3/h2H2,1H3 |
| InChIKey | FGJOVZHRAVJEGO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.94 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173053941 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173053941?
The IUPAC name of CID 173053941 (CID 173053941) is not available.
What is the SMILES notation for CID 173053941?
The canonical SMILES for CID 173053941 is [B]CS(C)=O.
What is the InChIKey of CID 173053941?
The InChIKey is FGJOVZHRAVJEGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5BOS/c1-5(4)2-3/h2H2,1H3.
What are the key properties of CID 173053941?
CID 173053941 has a molecular weight of 87.94 g/mol, XLogP of -0.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173053941 is sourced from PubChem (CID 173053941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).