About hydroxymethanesulfinate
hydroxymethanesulfinate (PubChem CID 3566445) has the molecular formula CH3O3S-
and a molecular weight of 95.10 g/mol. Its IUPAC name is hydroxymethanesulfinate.
Molecular Properties
| Compound Name | hydroxymethanesulfinate |
| PubChem CID | 3566445 |
| Molecular Formula | CH3O3S- |
| Molecular Weight | 95.10 g/mol |
| Exact Mass | 94.98 |
| IUPAC Name | hydroxymethanesulfinate |
| SMILES | O=S([O-])CO |
| InChI | InChI=1S/CH4O3S/c2-1-5(3)4/h2H,1H2,(H,3,4)/p-1 |
| InChIKey | SBGKURINHGJRFN-UHFFFAOYSA-M |
| XLogP | -1.18 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.10 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethanesulfinate?
The IUPAC name of hydroxymethanesulfinate (CID 3566445) is hydroxymethanesulfinate.
What is the SMILES notation for hydroxymethanesulfinate?
The canonical SMILES for hydroxymethanesulfinate is O=S([O-])CO.
What is the InChIKey of hydroxymethanesulfinate?
The InChIKey is SBGKURINHGJRFN-UHFFFAOYSA-M. The full InChI is InChI=1S/CH4O3S/c2-1-5(3)4/h2H,1H2,(H,3,4)/p-1.
What are the key properties of hydroxymethanesulfinate?
hydroxymethanesulfinate has a molecular weight of 95.10 g/mol, XLogP of -1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethanesulfinate is sourced from PubChem (CID 3566445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).