About CID 174978935
CID 174978935 (PubChem CID 174978935) has the molecular formula CH6BClN3O
and a molecular weight of 122.34 g/mol.
Molecular Properties
| Compound Name | CID 174978935 |
| PubChem CID | 174978935 |
| Molecular Formula | CH6BClN3O |
| Molecular Weight | 122.34 g/mol |
| Exact Mass | 122.03 |
| IUPAC Name | — |
| SMILES | Cl.[B]=O.[H]N=C(N)N |
| InChI | InChI=1S/CH5N3.BO.ClH/c2-1(3)4;1-2;/h(H5,2,3,4);;1H |
| InChIKey | QOIQYXSBPJOXCF-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.34 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174978935 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174978935?
The IUPAC name of CID 174978935 (CID 174978935) is not available.
What is the SMILES notation for CID 174978935?
The canonical SMILES for CID 174978935 is Cl.[B]=O.[H]N=C(N)N.
What is the InChIKey of CID 174978935?
The InChIKey is QOIQYXSBPJOXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N3.BO.ClH/c2-1(3)4;1-2;/h(H5,2,3,4);;1H.
What are the key properties of CID 174978935?
CID 174978935 has a molecular weight of 122.34 g/mol, XLogP of -1.24, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174978935 is sourced from PubChem (CID 174978935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).