C6H12N2 — CID 167286267
(1E,3Z)-2,3-dimethylbuta-1,3-diene-1,4-diamine (PubChem CID 167286267) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (1E,3Z)-2,3-dimethylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-2,3-dimethylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 167286267 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1E,3Z)-2,3-dimethylbuta-1,3-diene-1,4-diamine |
| SMILES | CC(=C/N)/C(C)=C/N |
| InChI | InChI=1S/C6H12N2/c1-5(3-7)6(2)4-8/h3-4H,7-8H2,1-2H3/b5-3-,6-4+ |
| InChIKey | NTESEVOUMZNEDR-CIIODKQPSA-N |
| XLogP | 0.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|