C9H20N2 — CID 171509109
ethane;(1Z,3Z)-2-ethyl-3-methylbuta-1,3-diene-1,4-diamine (PubChem CID 171509109) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is ethane;(1Z,3Z)-2-ethyl-3-methylbuta-1,3-diene-1,4-diamine.
| Compound Name | ethane;(1Z,3Z)-2-ethyl-3-methylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 171509109 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | ethane;(1Z,3Z)-2-ethyl-3-methylbuta-1,3-diene-1,4-diamine |
| SMILES | CC.CCC(=C/N)/C(C)=C\N |
| InChI | InChI=1S/C7H14N2.C2H6/c1-3-7(5-9)6(2)4-8;1-2/h4-5H,3,8-9H2,1-2H3;1-2H3/b6-4-,7-5-; |
| InChIKey | OWLNDMIWJZKXIM-ISOJEIHBSA-N |
| XLogP | 2.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|