C7H3N5 — CID 101240294
2-amino-4-iminobuta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 101240294) has the molecular formula C7H3N5 and a molecular weight of 157.14 g/mol. Its IUPAC name is 2-amino-4-iminobuta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-4-iminobuta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 101240294 |
| Molecular Formula | C7H3N5 |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 2-amino-4-iminobuta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(=C=N)C(N)=C(C#N)C#N |
| InChI | InChI=1S/C7H3N5/c8-1-5(2-9)7(12)6(3-10)4-11/h8H,12H2 |
| InChIKey | BJDTVEFBSUSDAJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|