C19H10N4 — CID 139240607
3-cyclopenta-2,4-dien-1-ylidene-5-imino-2-phenylpenta-1,4-diene-1,1,4-tricarbonitrile (PubChem CID 139240607) has the molecular formula C19H10N4 and a molecular weight of 294.32 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-ylidene-5-imino-2-phenylpenta-1,4-diene-1,1,4-tricarbonitrile.
| Compound Name | 3-cyclopenta-2,4-dien-1-ylidene-5-imino-2-phenylpenta-1,4-diene-1,1,4-tricarbonitrile |
|---|---|
| PubChem CID | 139240607 |
| Molecular Formula | C19H10N4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-ylidene-5-imino-2-phenylpenta-1,4-diene-1,1,4-tricarbonitrile |
| SMILES | N#CC(=C=N)C(=C1C=CC=C1)C(=C(C#N)C#N)c1ccccc1 |
| InChI | InChI=1S/C19H10N4/c20-10-16(11-21)18(14-6-2-1-3-7-14)19(17(12-22)13-23)15-8-4-5-9-15/h1-9,22H |
| InChIKey | ZVHVTEVKYZFCJN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|