C14H13N2O- — CID 4166272
N-(1-cyclopenta-2,4-dien-1-ylideneethyl)benzenecarbohydrazonate (PubChem CID 4166272) has the molecular formula C14H13N2O- and a molecular weight of 225.27 g/mol. Its IUPAC name is N-(1-cyclopenta-2,4-dien-1-ylideneethyl)benzenecarbohydrazonate.
| Compound Name | N-(1-cyclopenta-2,4-dien-1-ylideneethyl)benzenecarbohydrazonate |
|---|---|
| PubChem CID | 4166272 |
| Molecular Formula | C14H13N2O- |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-(1-cyclopenta-2,4-dien-1-ylideneethyl)benzenecarbohydrazonate |
| SMILES | CC(NN=C([O-])c1ccccc1)=C1C=CC=C1 |
| InChI | InChI=1S/C14H14N2O/c1-11(12-7-5-6-8-12)15-16-14(17)13-9-3-2-4-10-13/h2-10,15H,1H3,(H,16,17)/p-1 |
| InChIKey | WWXROFRQPSKOJK-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 47.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|