C19H14FeO4 — CID 159102143
cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate;1-cyclopenta-2,4-dien-1-ylidene-2-oxo-2-phenylethanolate;iron(2+) (PubChem CID 159102143) has the molecular formula C19H14FeO4 and a molecular weight of 362.16 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate;1-cyclopenta-2,4-dien-1-ylidene-2-oxo-2-phenylethanolate;iron(2+).
| Compound Name | cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate;1-cyclopenta-2,4-dien-1-ylidene-2-oxo-2-phenylethanolate;iron(2+) |
|---|---|
| PubChem CID | 159102143 |
| Molecular Formula | C19H14FeO4 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate;1-cyclopenta-2,4-dien-1-ylidene-2-oxo-2-phenylethanolate;iron(2+) |
| SMILES | O=C(C([O-])=C1C=CC=C1)c1ccccc1.[Fe+2].[O-]C(O)=C1C=CC=C1 |
| InChI | InChI=1S/C13H10O2.C6H6O2.Fe/c14-12(10-6-2-1-3-7-10)13(15)11-8-4-5-9-11;7-6(8)5-3-1-2-4-5;/h1-9,15H;1-4,7-8H;/q;;+2/p-2 |
| InChIKey | ZYUBRMBXLOZQJK-UHFFFAOYSA-L |
| XLogP | 1.85 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|