C12H10FeO4-2 — CID 171395328
bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate);iron (PubChem CID 171395328) has the molecular formula C12H10FeO4-2 and a molecular weight of 274.05 g/mol. Its IUPAC name is bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate);iron.
| Compound Name | bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate);iron |
|---|---|
| PubChem CID | 171395328 |
| Molecular Formula | C12H10FeO4-2 |
| Molecular Weight | 274.05 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate);iron |
| SMILES | [Fe].[O-]C(O)=C1C=CC=C1.[O-]C(O)=C1C=CC=C1 |
| InChI | InChI=1S/2C6H6O2.Fe/c2*7-6(8)5-3-1-2-4-5;/h2*1-4,7-8H;/p-2 |
| InChIKey | MPGFKQFJFGVVBN-UHFFFAOYSA-L |
| XLogP | 0.48 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.05 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|