C7H6Cl2O — CID 12723680
2,2-dichloro-1-cyclopenta-2,4-dien-1-ylideneethanol (PubChem CID 12723680) has the molecular formula C7H6Cl2O and a molecular weight of 177.03 g/mol. Its IUPAC name is 2,2-dichloro-1-cyclopenta-2,4-dien-1-ylideneethanol.
| Compound Name | 2,2-dichloro-1-cyclopenta-2,4-dien-1-ylideneethanol |
|---|---|
| PubChem CID | 12723680 |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | 2,2-dichloro-1-cyclopenta-2,4-dien-1-ylideneethanol |
| SMILES | OC(=C1C=CC=C1)C(Cl)Cl |
| InChI | InChI=1S/C7H6Cl2O/c8-7(9)6(10)5-3-1-2-4-5/h1-4,7,10H |
| InChIKey | HOPHZDKLKIHYMB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|