C11H10ClCoO- — CID 167440879
chloro(cyclopenta-2,4-dien-1-ylidene)methanol;cobalt;cyclopenta-1,3-diene (PubChem CID 167440879) has the molecular formula C11H10ClCoO- and a molecular weight of 252.59 g/mol. Its IUPAC name is chloro(cyclopenta-2,4-dien-1-ylidene)methanol;cobalt;cyclopenta-1,3-diene.
| Compound Name | chloro(cyclopenta-2,4-dien-1-ylidene)methanol;cobalt;cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 167440879 |
| Molecular Formula | C11H10ClCoO- |
| Molecular Weight | 252.59 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | chloro(cyclopenta-2,4-dien-1-ylidene)methanol;cobalt;cyclopenta-1,3-diene |
| SMILES | OC(Cl)=C1C=CC=C1.[Co].c1cc[cH-]c1 |
| InChI | InChI=1S/C6H5ClO.C5H5.Co/c7-6(8)5-3-1-2-4-5;1-2-4-5-3-1;/h1-4,8H;1-5H;/q;-1; |
| InChIKey | SCSGLRKGEWYGII-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|