C25H21Fe2NO3 — CID 172991410
N,N-bis[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]prop-2-ynamide;bis(cyclopenta-1,3-diene);iron;iron(2+) (PubChem CID 172991410) has the molecular formula C25H21Fe2NO3 and a molecular weight of 495.14 g/mol. Its IUPAC name is N,N-bis[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]prop-2-ynamide;bis(cyclopenta-1,3-diene);iron;iron(2+).
| Compound Name | N,N-bis[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]prop-2-ynamide;bis(cyclopenta-1,3-diene);iron;iron(2+) |
|---|---|
| PubChem CID | 172991410 |
| Molecular Formula | C25H21Fe2NO3 |
| Molecular Weight | 495.14 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | N,N-bis[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]prop-2-ynamide;bis(cyclopenta-1,3-diene);iron;iron(2+) |
| SMILES | C#CC(=O)N(C(O)=C1C=CC=C1)C(O)=C1C=CC=C1.[Fe+2].[Fe].c1cc[cH-]c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C15H11NO3.2C5H5.2Fe/c1-2-13(17)16(14(18)11-7-3-4-8-11)15(19)12-9-5-6-10-12;2*1-2-4-5-3-1;;/h1,3-10,18-19H;2*1-5H;;/q;2*-1;;+2 |
| InChIKey | HDKHJTOTZDSSLY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.14 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|