C12H15FeN4O2- — CID 163364348
cyclopenta-1,3-diene;(5Z)-5-[hydrazinyl(hydroxy)methylidene]cyclopenta-1,3-diene-1-carbohydrazide;iron (PubChem CID 163364348) has the molecular formula C12H15FeN4O2- and a molecular weight of 303.12 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(5Z)-5-[hydrazinyl(hydroxy)methylidene]cyclopenta-1,3-diene-1-carbohydrazide;iron.
| Compound Name | cyclopenta-1,3-diene;(5Z)-5-[hydrazinyl(hydroxy)methylidene]cyclopenta-1,3-diene-1-carbohydrazide;iron |
|---|---|
| PubChem CID | 163364348 |
| Molecular Formula | C12H15FeN4O2- |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | cyclopenta-1,3-diene;(5Z)-5-[hydrazinyl(hydroxy)methylidene]cyclopenta-1,3-diene-1-carbohydrazide;iron |
| SMILES | NNC(=O)C1=CC=C/C1=C(/O)NN.[Fe].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H10N4O2.C5H5.Fe/c8-10-6(12)4-2-1-3-5(4)7(13)11-9;1-2-4-5-3-1;/h1-3,10,12H,8-9H2,(H,11,13);1-5H;/q;-1;/b6-4-;; |
| InChIKey | KQDDCPGTLRFPKP-XFUGJFOESA-N |
| XLogP | 0.11 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|