C13H15FeO3- — CID 176895077
cyclopenta-1,3-diene;2-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methoxy]ethanol;iron (PubChem CID 176895077) has the molecular formula C13H15FeO3- and a molecular weight of 275.11 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methoxy]ethanol;iron.
| Compound Name | cyclopenta-1,3-diene;2-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methoxy]ethanol;iron |
|---|---|
| PubChem CID | 176895077 |
| Molecular Formula | C13H15FeO3- |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | cyclopenta-1,3-diene;2-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methoxy]ethanol;iron |
| SMILES | OCCOC(O)=C1C=CC=C1.[Fe].c1cc[cH-]c1 |
| InChI | InChI=1S/C8H10O3.C5H5.Fe/c9-5-6-11-8(10)7-3-1-2-4-7;1-2-4-5-3-1;/h1-4,9-10H,5-6H2;1-5H;/q;-1; |
| InChIKey | RRNIZKBMWLOWGF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|