C21H29BrFeO — CID 160872431
11-bromo-1-cyclopenta-2,4-dien-1-ylideneundecan-1-olate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 160872431) has the molecular formula C21H29BrFeO and a molecular weight of 433.21 g/mol. Its IUPAC name is 11-bromo-1-cyclopenta-2,4-dien-1-ylideneundecan-1-olate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 11-bromo-1-cyclopenta-2,4-dien-1-ylideneundecan-1-olate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 160872431 |
| Molecular Formula | C21H29BrFeO |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 11-bromo-1-cyclopenta-2,4-dien-1-ylideneundecan-1-olate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | [Fe+2].[O-]C(CCCCCCCCCCBr)=C1C=CC=C1.c1cc[cH-]c1 |
| InChI | InChI=1S/C16H25BrO.C5H5.Fe/c17-14-10-6-4-2-1-3-5-7-13-16(18)15-11-8-9-12-15;1-2-4-5-3-1;/h8-9,11-12,18H,1-7,10,13-14H2;1-5H;/q;-1;+2/p-1 |
| InChIKey | YMEFHHUNTJKIQR-UHFFFAOYSA-M |
| XLogP | 6.04 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|