C16H16FeO4 — CID 175703716
cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene(1-prop-2-enoyloxyethoxy)methanolate;iron(2+) (PubChem CID 175703716) has the molecular formula C16H16FeO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene(1-prop-2-enoyloxyethoxy)methanolate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene(1-prop-2-enoyloxyethoxy)methanolate;iron(2+) |
|---|---|
| PubChem CID | 175703716 |
| Molecular Formula | C16H16FeO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene(1-prop-2-enoyloxyethoxy)methanolate;iron(2+) |
| SMILES | C=CC(=O)OC(C)OC([O-])=C1C=CC=C1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C11H12O4.C5H5.Fe/c1-3-10(12)14-8(2)15-11(13)9-6-4-5-7-9;1-2-4-5-3-1;/h3-8,13H,1H2,2H3;1-5H;/q;-1;+2/p-1 |
| InChIKey | ZEULMYSKGWIHIC-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|