C11H11FeO3 — CID 169092793
cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidenemethanediol;oxoiron(1+) (PubChem CID 169092793) has the molecular formula C11H11FeO3 and a molecular weight of 247.05 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidenemethanediol;oxoiron(1+).
| Compound Name | cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidenemethanediol;oxoiron(1+) |
|---|---|
| PubChem CID | 169092793 |
| Molecular Formula | C11H11FeO3 |
| Molecular Weight | 247.05 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidenemethanediol;oxoiron(1+) |
| SMILES | O=[Fe+].OC(O)=C1C=CC=C1.c1cc[cH-]c1 |
| InChI | InChI=1S/C6H6O2.C5H5.Fe.O/c7-6(8)5-3-1-2-4-5;1-2-4-5-3-1;;/h1-4,7-8H;1-5H;;/q;-1;+1; |
| InChIKey | DMHVJHAIMCYNRK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.05 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|