About bis(cyclopenta-1,3-diene);nickel
bis(cyclopenta-1,3-diene);nickel (PubChem CID 25199994) has the molecular formula C10H10Ni-2
and a molecular weight of 188.88 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);nickel.
Molecular Properties
| Compound Name | bis(cyclopenta-1,3-diene);nickel |
| PubChem CID | 25199994 |
| Molecular Formula | C10H10Ni-2 |
| Molecular Weight | 188.88 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | bis(cyclopenta-1,3-diene);nickel |
| SMILES | [Ni].c1cc[cH-]c1.c1cc[cH-]c1 |
| InChI | InChI=1S/2C5H5.Ni/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1; |
| InChIKey | LQRAUTZMXJJEMK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopenta-1,3-diene);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopenta-1,3-diene);nickel?
The IUPAC name of bis(cyclopenta-1,3-diene);nickel (CID 25199994) is bis(cyclopenta-1,3-diene);nickel.
What is the SMILES notation for bis(cyclopenta-1,3-diene);nickel?
The canonical SMILES for bis(cyclopenta-1,3-diene);nickel is [Ni].c1cc[cH-]c1.c1cc[cH-]c1.
What is the InChIKey of bis(cyclopenta-1,3-diene);nickel?
The InChIKey is LQRAUTZMXJJEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Ni/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;.
What are the key properties of bis(cyclopenta-1,3-diene);nickel?
bis(cyclopenta-1,3-diene);nickel has a molecular weight of 188.88 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopenta-1,3-diene);nickel is sourced from PubChem (CID 25199994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).