About dilithium;cycloocta-1,3,6-triene
dilithium;cycloocta-1,3,6-triene (PubChem CID 15972602) has the molecular formula C8H8Li2
and a molecular weight of 118.03 g/mol. Its IUPAC name is dilithium;cycloocta-1,3,6-triene.
Molecular Properties
| Compound Name | dilithium;cycloocta-1,3,6-triene |
| PubChem CID | 15972602 |
| Molecular Formula | C8H8Li2 |
| Molecular Weight | 118.03 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | dilithium;cycloocta-1,3,6-triene |
| SMILES | [Li+].[Li+].c1cc[cH-]cc[cH-]c1 |
| InChI | InChI=1S/C8H8.2Li/c1-2-4-6-8-7-5-3-1;;/h1-8H;;/q-2;2*+1/b2-1-,5-3-,8-6-;; |
| InChIKey | SECBSXNYDJOATE-YGFQESQOSA-N |
| XLogP | -3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.03 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;cycloocta-1,3,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;cycloocta-1,3,6-triene?
The IUPAC name of dilithium;cycloocta-1,3,6-triene (CID 15972602) is dilithium;cycloocta-1,3,6-triene.
What is the SMILES notation for dilithium;cycloocta-1,3,6-triene?
The canonical SMILES for dilithium;cycloocta-1,3,6-triene is [Li+].[Li+].c1cc[cH-]cc[cH-]c1.
What is the InChIKey of dilithium;cycloocta-1,3,6-triene?
The InChIKey is SECBSXNYDJOATE-YGFQESQOSA-N. The full InChI is InChI=1S/C8H8.2Li/c1-2-4-6-8-7-5-3-1;;/h1-8H;;/q-2;2*+1/b2-1-,5-3-,8-6-;;.
What are the key properties of dilithium;cycloocta-1,3,6-triene?
dilithium;cycloocta-1,3,6-triene has a molecular weight of 118.03 g/mol, XLogP of -3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;cycloocta-1,3,6-triene is sourced from PubChem (CID 15972602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).