C8H8Li2 — CID 15972602
dilithium;cycloocta-1,3,6-triene (PubChem CID 15972602) has the molecular formula C8H8Li2 and a molecular weight of 118.03 g/mol. Its IUPAC name is dilithium;cycloocta-1,3,6-triene.
| Compound Name | dilithium;cycloocta-1,3,6-triene |
|---|---|
| PubChem CID | 15972602 |
| Molecular Formula | C8H8Li2 |
| Molecular Weight | 118.03 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | dilithium;cycloocta-1,3,6-triene |
| SMILES | [Li+].[Li+].c1cc[cH-]cc[cH-]c1 |
| InChI | InChI=1S/C8H8.2Li/c1-2-4-6-8-7-5-3-1;;/h1-8H;;/q-2;2*+1/b2-1-,5-3-,8-6-;; |
| InChIKey | SECBSXNYDJOATE-YGFQESQOSA-N |
| XLogP | -3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.03 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|