C23H36FeNO- — CID 170566479
2-amino-1-cyclopenta-2,4-dien-1-ylidenetridecan-1-ol;cyclopenta-1,3-diene;iron (PubChem CID 170566479) has the molecular formula C23H36FeNO- and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-amino-1-cyclopenta-2,4-dien-1-ylidenetridecan-1-ol;cyclopenta-1,3-diene;iron.
| Compound Name | 2-amino-1-cyclopenta-2,4-dien-1-ylidenetridecan-1-ol;cyclopenta-1,3-diene;iron |
|---|---|
| PubChem CID | 170566479 |
| Molecular Formula | C23H36FeNO- |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-amino-1-cyclopenta-2,4-dien-1-ylidenetridecan-1-ol;cyclopenta-1,3-diene;iron |
| SMILES | CCCCCCCCCCCC(N)C(O)=C1C=CC=C1.[Fe].c1cc[cH-]c1 |
| InChI | InChI=1S/C18H31NO.C5H5.Fe/c1-2-3-4-5-6-7-8-9-10-15-17(19)18(20)16-13-11-12-14-16;1-2-4-5-3-1;/h11-14,17,20H,2-10,15,19H2,1H3;1-5H;/q;-1; |
| InChIKey | MUSJANIONZVMAP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|