C28H34Fe2-8 — CID 173056174
cyclopenta-1,3-diene;5-(1-cyclopenta-2,4-dien-1-yloctyl)cyclopenta-1,3-diene;cyclopentane;iron (PubChem CID 173056174) has the molecular formula C28H34Fe2-8 and a molecular weight of 482.27 g/mol. Its IUPAC name is cyclopenta-1,3-diene;5-(1-cyclopenta-2,4-dien-1-yloctyl)cyclopenta-1,3-diene;cyclopentane;iron.
| Compound Name | cyclopenta-1,3-diene;5-(1-cyclopenta-2,4-dien-1-yloctyl)cyclopenta-1,3-diene;cyclopentane;iron |
|---|---|
| PubChem CID | 173056174 |
| Molecular Formula | C28H34Fe2-8 |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | cyclopenta-1,3-diene;5-(1-cyclopenta-2,4-dien-1-yloctyl)cyclopenta-1,3-diene;cyclopentane;iron |
| SMILES | CCCCCCCC([c-]1cccc1)[c-]1cccc1.[Fe].[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.c1cc[cH-]c1 |
| InChI | InChI=1S/C18H24.2C5H5.2Fe/c1-2-3-4-5-6-15-18(16-11-7-8-12-16)17-13-9-10-14-17;2*1-2-4-5-3-1;;/h7-14,18H,2-6,15H2,1H3;2*1-5H;;/q-2;-5;-1;; |
| InChIKey | SIHSMRRQBKZBBL-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|