C19H15FeIO — CID 139234486
cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-olate;iron(2+) (PubChem CID 139234486) has the molecular formula C19H15FeIO and a molecular weight of 442.08 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-olate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-olate;iron(2+) |
|---|---|
| PubChem CID | 139234486 |
| Molecular Formula | C19H15FeIO |
| Molecular Weight | 442.08 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-olate;iron(2+) |
| SMILES | [Fe+2].[O-]/C(=C\C=C1C=CC=C1)c1ccc(I)cc1.c1cc[cH-]c1 |
| InChI | InChI=1S/C14H11IO.C5H5.Fe/c15-13-8-6-12(7-9-13)14(16)10-5-11-3-1-2-4-11;1-2-4-5-3-1;/h1-10,16H;1-5H;/q;-1;+2/p-1/b14-10-;; |
| InChIKey | ADEAKMBMRWJDTR-UFMFWQRBSA-M |
| XLogP | 4.45 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.08 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|