C20H17BF2FeO3 — CID 71592751
cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-6-methoxyphenyl)prop-1-en-1-olate;iron(2+) (PubChem CID 71592751) has the molecular formula C20H17BF2FeO3 and a molecular weight of 410.01 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-6-methoxyphenyl)prop-1-en-1-olate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-6-methoxyphenyl)prop-1-en-1-olate;iron(2+) |
|---|---|
| PubChem CID | 71592751 |
| Molecular Formula | C20H17BF2FeO3 |
| Molecular Weight | 410.01 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-6-methoxyphenyl)prop-1-en-1-olate;iron(2+) |
| SMILES | COc1cccc(OB(F)F)c1/C([O-])=C/C=C1C=CC=C1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C15H13BF2O3.C5H5.Fe/c1-20-13-7-4-8-14(21-16(17)18)15(13)12(19)10-9-11-5-2-3-6-11;1-2-4-5-3-1;/h2-10,19H,1H3;1-5H;/q;-1;+2/p-1/b12-10-;; |
| InChIKey | KFFZBAMLISLAAM-VSXCOVETSA-M |
| XLogP | 4.15 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|