C19H14F2FeO2 — CID 78124780
cyclopenta-1,3-diene;2-(3-cyclopenta-2,4-dien-1-ylidene-1-hydroxyprop-1-enyl)-4,6-difluorophenolate;iron(2+) (PubChem CID 78124780) has the molecular formula C19H14F2FeO2 and a molecular weight of 368.16 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-(3-cyclopenta-2,4-dien-1-ylidene-1-hydroxyprop-1-enyl)-4,6-difluorophenolate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-(3-cyclopenta-2,4-dien-1-ylidene-1-hydroxyprop-1-enyl)-4,6-difluorophenolate;iron(2+) |
|---|---|
| PubChem CID | 78124780 |
| Molecular Formula | C19H14F2FeO2 |
| Molecular Weight | 368.16 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | cyclopenta-1,3-diene;2-(3-cyclopenta-2,4-dien-1-ylidene-1-hydroxyprop-1-enyl)-4,6-difluorophenolate;iron(2+) |
| SMILES | [Fe+2].[O-]c1c(F)cc(F)cc1C(O)=CC=C1C=CC=C1.c1cc[cH-]c1 |
| InChI | InChI=1S/C14H10F2O2.C5H5.Fe/c15-10-7-11(14(18)12(16)8-10)13(17)6-5-9-3-1-2-4-9;1-2-4-5-3-1;/h1-8,17-18H;1-5H;/q;-1;+2/p-1 |
| InChIKey | VVXCODOSDAEKGW-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|