C15H16FeO2 — CID 50909408
cyclopenta-1,3-diene;(E)-3-cyclopenta-2,4-dien-1-ylidene-1-ethoxyprop-1-en-1-olate;iron(2+) (PubChem CID 50909408) has the molecular formula C15H16FeO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(E)-3-cyclopenta-2,4-dien-1-ylidene-1-ethoxyprop-1-en-1-olate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;(E)-3-cyclopenta-2,4-dien-1-ylidene-1-ethoxyprop-1-en-1-olate;iron(2+) |
|---|---|
| PubChem CID | 50909408 |
| Molecular Formula | C15H16FeO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | cyclopenta-1,3-diene;(E)-3-cyclopenta-2,4-dien-1-ylidene-1-ethoxyprop-1-en-1-olate;iron(2+) |
| SMILES | CCO/C([O-])=C/C=C1C=CC=C1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C10H12O2.C5H5.Fe/c1-2-12-10(11)8-7-9-5-3-4-6-9;1-2-4-5-3-1;/h3-8,11H,2H2,1H3;1-5H;/q;-1;+2/p-1/b10-8+;; |
| InChIKey | OBMDYEJPZYMVAU-PIHABLKOSA-M |
| XLogP | 2.68 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|