C19H16FeO — CID 57351793
cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-phenylprop-1-en-1-olate;iron(2+) (PubChem CID 57351793) has the molecular formula C19H16FeO and a molecular weight of 316.18 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-phenylprop-1-en-1-olate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-phenylprop-1-en-1-olate;iron(2+) |
|---|---|
| PubChem CID | 57351793 |
| Molecular Formula | C19H16FeO |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-phenylprop-1-en-1-olate;iron(2+) |
| SMILES | [Fe+2].[O-]C(=CC=C1C=CC=C1)c1ccccc1.c1cc[cH-]c1 |
| InChI | InChI=1S/C14H12O.C5H5.Fe/c15-14(13-8-2-1-3-9-13)11-10-12-6-4-5-7-12;1-2-4-5-3-1;/h1-11,15H;1-5H;/q;-1;+2/p-1 |
| InChIKey | WOHMUERAUARSGS-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|