C21H20FeO4 — CID 71592851
cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-1-en-1-olate;iron(2+) (PubChem CID 71592851) has the molecular formula C21H20FeO4 and a molecular weight of 392.23 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-1-en-1-olate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-1-en-1-olate;iron(2+) |
|---|---|
| PubChem CID | 71592851 |
| Molecular Formula | C21H20FeO4 |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | cyclopenta-1,3-diene;(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-1-en-1-olate;iron(2+) |
| SMILES | COc1cc(O)c(/C([O-])=C/C=C2C=CC=C2)c(OC)c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C16H16O4.C5H5.Fe/c1-19-12-9-14(18)16(15(10-12)20-2)13(17)8-7-11-5-3-4-6-11;1-2-4-5-3-1;/h3-10,17-18H,1-2H3;1-5H;/q;-1;+2/p-1/b13-8-;; |
| InChIKey | FQGZOEGGICFMKI-KEZMYAPCSA-M |
| XLogP | 3.57 |
| TPSA | 61.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|