C11H14O5 — CID 10955251
3-hydroxy-1-(2-hydroxy-4,6-dimethoxyphenyl)propan-1-one (PubChem CID 10955251) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-hydroxy-1-(2-hydroxy-4,6-dimethoxyphenyl)propan-1-one.
| Compound Name | 3-hydroxy-1-(2-hydroxy-4,6-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 10955251 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-hydroxy-1-(2-hydroxy-4,6-dimethoxyphenyl)propan-1-one |
| SMILES | COc1cc(O)c(C(=O)CCO)c(OC)c1 |
| InChI | InChI=1S/C11H14O5/c1-15-7-5-9(14)11(8(13)3-4-12)10(6-7)16-2/h5-6,12,14H,3-4H2,1-2H3 |
| InChIKey | JKLPUVIKMWEVBM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |