C17H16O6 — CID 90718650
1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione (PubChem CID 90718650) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione.
| Compound Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 90718650 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione |
| SMILES | COc1cc(O)c(C(=O)CC(=O)c2ccc(O)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H16O6/c1-22-12-7-14(20)17(16(8-12)23-2)15(21)9-13(19)10-3-5-11(18)6-4-10/h3-8,18,20H,9H2,1-2H3 |
| InChIKey | MJQUZVRVCHUFDY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|