C22H18O6 — CID 101020851
4-(2-hydroxy-4,6-dimethoxyphenyl)-1-naphthalen-2-ylbutane-1,2,4-trione (PubChem CID 101020851) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is 4-(2-hydroxy-4,6-dimethoxyphenyl)-1-naphthalen-2-ylbutane-1,2,4-trione.
| Compound Name | 4-(2-hydroxy-4,6-dimethoxyphenyl)-1-naphthalen-2-ylbutane-1,2,4-trione |
|---|---|
| PubChem CID | 101020851 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-(2-hydroxy-4,6-dimethoxyphenyl)-1-naphthalen-2-ylbutane-1,2,4-trione |
| SMILES | COc1cc(O)c(C(=O)CC(=O)C(=O)c2ccc3ccccc3c2)c(OC)c1 |
| InChI | InChI=1S/C22H18O6/c1-27-16-10-17(23)21(20(11-16)28-2)18(24)12-19(25)22(26)15-8-7-13-5-3-4-6-14(13)9-15/h3-11,23H,12H2,1-2H3 |
| InChIKey | QTXPDZXBJJQRMK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|