C11H12BrClO3 — CID 104645831
1-(2-bromo-4,6-dimethoxyphenyl)-3-chloropropan-1-one (PubChem CID 104645831) has the molecular formula C11H12BrClO3 and a molecular weight of 307.57 g/mol. Its IUPAC name is 1-(2-bromo-4,6-dimethoxyphenyl)-3-chloropropan-1-one.
| Compound Name | 1-(2-bromo-4,6-dimethoxyphenyl)-3-chloropropan-1-one |
|---|---|
| PubChem CID | 104645831 |
| Molecular Formula | C11H12BrClO3 |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 1-(2-bromo-4,6-dimethoxyphenyl)-3-chloropropan-1-one |
| SMILES | COc1cc(Br)c(C(=O)CCCl)c(OC)c1 |
| InChI | InChI=1S/C11H12BrClO3/c1-15-7-5-8(12)11(9(14)3-4-13)10(6-7)16-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | ZQODUYUPKJVVQI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|