C19H15FFeO2 — CID 157292063
cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-(4-fluoro-2-hydroxyphenyl)prop-1-en-1-olate;iron(2+) (PubChem CID 157292063) has the molecular formula C19H15FFeO2 and a molecular weight of 350.17 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-(4-fluoro-2-hydroxyphenyl)prop-1-en-1-olate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-(4-fluoro-2-hydroxyphenyl)prop-1-en-1-olate;iron(2+) |
|---|---|
| PubChem CID | 157292063 |
| Molecular Formula | C19H15FFeO2 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | cyclopenta-1,3-diene;3-cyclopenta-2,4-dien-1-ylidene-1-(4-fluoro-2-hydroxyphenyl)prop-1-en-1-olate;iron(2+) |
| SMILES | [Fe+2].[O-]C(=CC=C1C=CC=C1)c1ccc(F)cc1O.c1cc[cH-]c1 |
| InChI | InChI=1S/C14H11FO2.C5H5.Fe/c15-11-6-7-12(14(17)9-11)13(16)8-5-10-3-1-2-4-10;1-2-4-5-3-1;/h1-9,16-17H;1-5H;/q;-1;+2/p-1 |
| InChIKey | FAYSHQGHPJXCRC-UHFFFAOYSA-M |
| XLogP | 3.69 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|