C19H14BClF2FeO2 — CID 71592857
(Z)-1-(5-chloro-2-difluoroboranyloxyphenyl)-3-cyclopenta-2,4-dien-1-ylideneprop-1-en-1-olate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 71592857) has the molecular formula C19H14BClF2FeO2 and a molecular weight of 414.43 g/mol. Its IUPAC name is (Z)-1-(5-chloro-2-difluoroboranyloxyphenyl)-3-cyclopenta-2,4-dien-1-ylideneprop-1-en-1-olate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | (Z)-1-(5-chloro-2-difluoroboranyloxyphenyl)-3-cyclopenta-2,4-dien-1-ylideneprop-1-en-1-olate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 71592857 |
| Molecular Formula | C19H14BClF2FeO2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | (Z)-1-(5-chloro-2-difluoroboranyloxyphenyl)-3-cyclopenta-2,4-dien-1-ylideneprop-1-en-1-olate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | [Fe+2].[O-]/C(=C\C=C1C=CC=C1)c1cc(Cl)ccc1OB(F)F.c1cc[cH-]c1 |
| InChI | InChI=1S/C14H10BClF2O2.C5H5.Fe/c16-11-6-8-14(20-15(17)18)12(9-11)13(19)7-5-10-3-1-2-4-10;1-2-4-5-3-1;/h1-9,19H;1-5H;/q;-1;+2/p-1/b13-7-;; |
| InChIKey | CAUSHPGBVBYFAX-ZFPLEQNJSA-M |
| XLogP | 4.80 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|