C15H16FeO3 — CID 159636847
1-cyclopenta-2,4-dien-1-ylideneethanolate;cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate;iron(2+) (PubChem CID 159636847) has the molecular formula C15H16FeO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylideneethanolate;cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate;iron(2+).
| Compound Name | 1-cyclopenta-2,4-dien-1-ylideneethanolate;cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate;iron(2+) |
|---|---|
| PubChem CID | 159636847 |
| Molecular Formula | C15H16FeO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylideneethanolate;cyclopenta-2,4-dien-1-ylidene(ethoxy)methanolate;iron(2+) |
| SMILES | CC([O-])=C1C=CC=C1.CCOC([O-])=C1C=CC=C1.[Fe+2] |
| InChI | InChI=1S/C8H10O2.C7H8O.Fe/c1-2-10-8(9)7-5-3-4-6-7;1-6(8)7-4-2-3-5-7;/h3-6,9H,2H2,1H3;2-5,8H,1H3;/q;;+2/p-2 |
| InChIKey | FMKITCNFZLFHLP-UHFFFAOYSA-L |
| XLogP | 1.47 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|