C26H26FeN4O4 — CID 51346239
(E)-ethoxy-[(15E)-15-[ethoxy(oxido)methylidene]-3,16-dimethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,13,16,18,20-decaen-4-ylidene]methanolate;iron(2+) (PubChem CID 51346239) has the molecular formula C26H26FeN4O4 and a molecular weight of 514.36 g/mol. Its IUPAC name is (E)-ethoxy-[(15E)-15-[ethoxy(oxido)methylidene]-3,16-dimethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,13,16,18,20-decaen-4-ylidene]methanolate;iron(2+).
| Compound Name | (E)-ethoxy-[(15E)-15-[ethoxy(oxido)methylidene]-3,16-dimethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,13,16,18,20-decaen-4-ylidene]methanolate;iron(2+) |
|---|---|
| PubChem CID | 51346239 |
| Molecular Formula | C26H26FeN4O4 |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | (E)-ethoxy-[(15E)-15-[ethoxy(oxido)methylidene]-3,16-dimethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,13,16,18,20-decaen-4-ylidene]methanolate;iron(2+) |
| SMILES | CCO/C([O-])=c1\cnc2ccccc2nc/c(=C(/[O-])OCC)c(C)nc2ccccc2nc1C.[Fe+2] |
| InChI | InChI=1S/C26H28N4O4.Fe/c1-5-33-25(31)19-15-27-21-11-7-8-12-22(21)28-16-20(26(32)34-6-2)18(4)30-24-14-10-9-13-23(24)29-17(19)3;/h7-16,31-32H,5-6H2,1-4H3;/q;+2/p-2/b25-19+,26-20+,27-15+,28-16+,29-17+,30-18+; |
| InChIKey | ZSKHNJYPYWAHEP-JUDWIBMXSA-L |
| XLogP | 1.36 |
| TPSA | 116.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|