C12H10CoO4 — CID 157122316
cobalt(2+);bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate) (PubChem CID 157122316) has the molecular formula C12H10CoO4 and a molecular weight of 277.14 g/mol. Its IUPAC name is cobalt(2+);bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate).
| Compound Name | cobalt(2+);bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate) |
|---|---|
| PubChem CID | 157122316 |
| Molecular Formula | C12H10CoO4 |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | cobalt(2+);bis(cyclopenta-2,4-dien-1-ylidene(hydroxy)methanolate) |
| SMILES | [Co+2].[O-]C(O)=C1C=CC=C1.[O-]C(O)=C1C=CC=C1 |
| InChI | InChI=1S/2C6H6O2.Co/c2*7-6(8)5-3-1-2-4-5;/h2*1-4,7-8H;/q;;+2/p-2 |
| InChIKey | LQJUZJFFWJPRQN-UHFFFAOYSA-L |
| XLogP | 0.48 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|