C10H13O- — CID 12725581
1-cyclopenta-2,4-dien-1-ylidene-2,2-dimethylpropan-1-olate (PubChem CID 12725581) has the molecular formula C10H13O- and a molecular weight of 149.21 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidene-2,2-dimethylpropan-1-olate.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylidene-2,2-dimethylpropan-1-olate |
|---|---|
| PubChem CID | 12725581 |
| Molecular Formula | C10H13O- |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylidene-2,2-dimethylpropan-1-olate |
| SMILES | CC(C)(C)C([O-])=C1C=CC=C1 |
| InChI | InChI=1S/C10H14O/c1-10(2,3)9(11)8-6-4-5-7-8/h4-7,11H,1-3H3/p-1 |
| InChIKey | FLDHQQLSODKICR-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|