About bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+)
bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) (PubChem CID 157072709) has the molecular formula C20H22FeO2
and a molecular weight of 350.24 g/mol. Its IUPAC name is bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+).
Molecular Properties
| Compound Name | bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) |
| PubChem CID | 157072709 |
| Molecular Formula | C20H22FeO2 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) |
| SMILES | CCC=CC([O-])=C1C=CC=C1.CCC=CC([O-])=C1C=CC=C1.[Fe+2] |
| InChI | InChI=1S/2C10H12O.Fe/c2*1-2-3-8-10(11)9-6-4-5-7-9;/h2*3-8,11H,2H2,1H3;/q;;+2/p-2 |
| InChIKey | LWACMCSKBNLFGU-UHFFFAOYSA-L |
| XLogP | 3.38 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+)?
The IUPAC name of bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) (CID 157072709) is bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+).
What is the SMILES notation for bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+)?
The canonical SMILES for bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) is CCC=CC([O-])=C1C=CC=C1.CCC=CC([O-])=C1C=CC=C1.[Fe+2].
What is the InChIKey of bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+)?
The InChIKey is LWACMCSKBNLFGU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H12O.Fe/c2*1-2-3-8-10(11)9-6-4-5-7-9;/h2*3-8,11H,2H2,1H3;/q;;+2/p-2.
What are the key properties of bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+)?
bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) has a molecular weight of 350.24 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-cyclopenta-2,4-dien-1-ylidenepent-2-en-1-olate);iron(2+) is sourced from PubChem (CID 157072709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).