About bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+)
bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) (PubChem CID 50922660) has the molecular formula C28H22FeO2
and a molecular weight of 446.33 g/mol. Its IUPAC name is bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+).
Molecular Properties
| Compound Name | bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) |
| PubChem CID | 50922660 |
| Molecular Formula | C28H22FeO2 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) |
| SMILES | [Fe+2].[O-]C(/C=C/c1ccccc1)=C1C=CC=C1.[O-]C(/C=C/c1ccccc1)=C1C=CC=C1 |
| InChI | InChI=1S/2C14H12O.Fe/c2*15-14(13-8-4-5-9-13)11-10-12-6-2-1-3-7-12;/h2*1-11,15H;/q;;+2/p-2/b2*11-10+; |
| InChIKey | VRIXXSDBNHSOSQ-OFLUISNTSA-L |
| XLogP | 4.88 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+)?
The IUPAC name of bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) (CID 50922660) is bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+).
What is the SMILES notation for bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+)?
The canonical SMILES for bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) is [Fe+2].[O-]C(/C=C/c1ccccc1)=C1C=CC=C1.[O-]C(/C=C/c1ccccc1)=C1C=CC=C1.
What is the InChIKey of bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+)?
The InChIKey is VRIXXSDBNHSOSQ-OFLUISNTSA-L. The full InChI is InChI=1S/2C14H12O.Fe/c2*15-14(13-8-4-5-9-13)11-10-12-6-2-1-3-7-12;/h2*1-11,15H;/q;;+2/p-2/b2*11-10+;.
What are the key properties of bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+)?
bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) has a molecular weight of 446.33 g/mol, XLogP of 4.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-1-cyclopenta-2,4-dien-1-ylidene-3-phenylprop-2-en-1-olate);iron(2+) is sourced from PubChem (CID 50922660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).