C9H11- — CID 162397478
5-butan-2-ylidenecyclopenta-1,3-diene (PubChem CID 162397478) has the molecular formula C9H11- and a molecular weight of 119.19 g/mol. Its IUPAC name is 5-butan-2-ylidenecyclopenta-1,3-diene.
| Compound Name | 5-butan-2-ylidenecyclopenta-1,3-diene |
|---|---|
| PubChem CID | 162397478 |
| Molecular Formula | C9H11- |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | 5-butan-2-ylidenecyclopenta-1,3-diene |
| SMILES | C[CH-]C(C)=C1C=CC=C1 |
| InChI | InChI=1S/C9H11/c1-3-8(2)9-6-4-5-7-9/h3-7H,1-2H3/q-1 |
| InChIKey | DBLCYQMFVUFQDP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|