About 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene
1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene (PubChem CID 172558213) has the molecular formula C13H15FeO-
and a molecular weight of 243.11 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene |
| PubChem CID | 172558213 |
| Molecular Formula | C13H15FeO- |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene |
| SMILES | CC(O)=C1C=CC=C1.C[c-]1cccc1.[Fe] |
| InChI | InChI=1S/C7H8O.C6H7.Fe/c1-6(8)7-4-2-3-5-7;1-6-4-2-3-5-6;/h2-5,8H,1H3;2-5H,1H3;/q;-1; |
| InChIKey | YIZDHUABSWCKMW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene (CID 172558213) is 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene is CC(O)=C1C=CC=C1.C[c-]1cccc1.[Fe].
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene?
The InChIKey is YIZDHUABSWCKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H7.Fe/c1-6(8)7-4-2-3-5-7;1-6-4-2-3-5-6;/h2-5,8H,1H3;2-5H,1H3;/q;-1;.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene?
1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene has a molecular weight of 243.11 g/mol, XLogP of 3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylideneethanol;iron;5-methylcyclopenta-1,3-diene is sourced from PubChem (CID 172558213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).