C10H12O — CID 140977465
1-cyclopenta-2,4-dien-1-ylidene-3-methylbut-2-en-1-ol (PubChem CID 140977465) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidene-3-methylbut-2-en-1-ol.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylidene-3-methylbut-2-en-1-ol |
|---|---|
| PubChem CID | 140977465 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylidene-3-methylbut-2-en-1-ol |
| SMILES | CC(C)=CC(O)=C1C=CC=C1 |
| InChI | InChI=1S/C10H12O/c1-8(2)7-10(11)9-5-3-4-6-9/h3-7,11H,1-2H3 |
| InChIKey | DMXCRAXQZHXXSB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|