C25H20FeO2 — CID 162009578
1-cyclopenta-2,4-dien-1-ylidene-2-phenylethanolate;cyclopenta-2,4-dien-1-ylidene(phenyl)methanolate;iron(2+) (PubChem CID 162009578) has the molecular formula C25H20FeO2 and a molecular weight of 408.28 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidene-2-phenylethanolate;cyclopenta-2,4-dien-1-ylidene(phenyl)methanolate;iron(2+).
| Compound Name | 1-cyclopenta-2,4-dien-1-ylidene-2-phenylethanolate;cyclopenta-2,4-dien-1-ylidene(phenyl)methanolate;iron(2+) |
|---|---|
| PubChem CID | 162009578 |
| Molecular Formula | C25H20FeO2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylidene-2-phenylethanolate;cyclopenta-2,4-dien-1-ylidene(phenyl)methanolate;iron(2+) |
| SMILES | [Fe+2].[O-]C(=C1C=CC=C1)c1ccccc1.[O-]C(Cc1ccccc1)=C1C=CC=C1 |
| InChI | InChI=1S/C13H12O.C12H10O.Fe/c14-13(12-8-4-5-9-12)10-11-6-2-1-3-7-11;13-12(11-8-4-5-9-11)10-6-2-1-3-7-10;/h1-9,14H,10H2;1-9,13H;/q;;+2/p-2 |
| InChIKey | OXXZAQCDHVANSJ-UHFFFAOYSA-L |
| XLogP | 3.85 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|