About 2-phenylethanimidate
2-phenylethanimidate (PubChem CID 23369568) has the molecular formula C8H8NO-
and a molecular weight of 134.16 g/mol. Its IUPAC name is 2-phenylethanimidate.
Molecular Properties
| Compound Name | 2-phenylethanimidate |
| PubChem CID | 23369568 |
| Molecular Formula | C8H8NO- |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 2-phenylethanimidate |
| SMILES | [H]/N=C(\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C8H9NO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10)/p-1 |
| InChIKey | LSBDFXRDZJMBSC-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethanimidate?
The IUPAC name of 2-phenylethanimidate (CID 23369568) is 2-phenylethanimidate.
What is the SMILES notation for 2-phenylethanimidate?
The canonical SMILES for 2-phenylethanimidate is [H]/N=C(\[O-])Cc1ccccc1.
What is the InChIKey of 2-phenylethanimidate?
The InChIKey is LSBDFXRDZJMBSC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10)/p-1.
What are the key properties of 2-phenylethanimidate?
2-phenylethanimidate has a molecular weight of 134.16 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethanimidate is sourced from PubChem (CID 23369568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).