C12H14N2O — CID 123236815
3,5-diimino-6-phenylhexan-2-one (PubChem CID 123236815) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3,5-diimino-6-phenylhexan-2-one.
| Compound Name | 3,5-diimino-6-phenylhexan-2-one |
|---|---|
| PubChem CID | 123236815 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3,5-diimino-6-phenylhexan-2-one |
| SMILES | [H]/N=C(\C/C(=N/[H])C(C)=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c1-9(15)12(14)8-11(13)7-10-5-3-2-4-6-10/h2-6,13-14H,7-8H2,1H3/b13-11-,14-12- |
| InChIKey | ZACJOCQCPBXZCX-XSYHWHKQSA-N |
| XLogP | 2.25 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|