C25H27N3O3Si — CID 141205802
N-[methyl-bis[(2-phenylacetyl)amino]silyl]-2-phenylacetamide (PubChem CID 141205802) has the molecular formula C25H27N3O3Si and a molecular weight of 445.60 g/mol. Its IUPAC name is N-[methyl-bis[(2-phenylacetyl)amino]silyl]-2-phenylacetamide.
| Compound Name | N-[methyl-bis[(2-phenylacetyl)amino]silyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 141205802 |
| Molecular Formula | C25H27N3O3Si |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[methyl-bis[(2-phenylacetyl)amino]silyl]-2-phenylacetamide |
| SMILES | C[Si](NC(=O)Cc1ccccc1)(NC(=O)Cc1ccccc1)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H27N3O3Si/c1-32(26-23(29)17-20-11-5-2-6-12-20,27-24(30)18-21-13-7-3-8-14-21)28-25(31)19-22-15-9-4-10-16-22/h2-16H,17-19H2,1H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | YJUNTFISKQEUBU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|