C17H26N2O2 — CID 174559227
(6-imino-2,4,4-trimethyl-7-phenylheptan-2-yl) carbamate (PubChem CID 174559227) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (6-imino-2,4,4-trimethyl-7-phenylheptan-2-yl) carbamate.
| Compound Name | (6-imino-2,4,4-trimethyl-7-phenylheptan-2-yl) carbamate |
|---|---|
| PubChem CID | 174559227 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (6-imino-2,4,4-trimethyl-7-phenylheptan-2-yl) carbamate |
| SMILES | [H]/N=C(/Cc1ccccc1)CC(C)(C)CC(C)(C)OC(N)=O |
| InChI | InChI=1S/C17H26N2O2/c1-16(2,12-17(3,4)21-15(19)20)11-14(18)10-13-8-6-5-7-9-13/h5-9,18H,10-12H2,1-4H3,(H2,19,20)/b18-14- |
| InChIKey | MXTYQNHBKHGISL-JXAWBTAJSA-N |
| XLogP | 3.93 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|