About [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate
[(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate (PubChem CID 174601590) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate.
Molecular Properties
| Compound Name | [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate |
| PubChem CID | 174601590 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate |
| SMILES | [H]/N=C(\C[C@@H](C)CC(C)(C)OC(N)=O)c1ccccc1N |
| InChI | InChI=1S/C15H23N3O2/c1-10(9-15(2,3)20-14(18)19)8-13(17)11-6-4-5-7-12(11)16/h4-7,10,17H,8-9,16H2,1-3H3,(H2,18,19)/b17-13+/t10-/m1/s1 |
| InChIKey | OUSSNRLZXCDEJP-VFDYIDLISA-N |
| XLogP | 2.93 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate?
The IUPAC name of [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate (CID 174601590) is [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate.
What is the SMILES notation for [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate?
The canonical SMILES for [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate is [H]/N=C(\C[C@@H](C)CC(C)(C)OC(N)=O)c1ccccc1N.
What is the InChIKey of [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate?
The InChIKey is OUSSNRLZXCDEJP-VFDYIDLISA-N. The full InChI is InChI=1S/C15H23N3O2/c1-10(9-15(2,3)20-14(18)19)8-13(17)11-6-4-5-7-12(11)16/h4-7,10,17H,8-9,16H2,1-3H3,(H2,18,19)/b17-13+/t10-/m1/s1.
What are the key properties of [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate?
[(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate has a molecular weight of 277.37 g/mol, XLogP of 2.93, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate is sourced from PubChem (CID 174601590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).