C15H23N3O2 — CID 174601590
[(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate (PubChem CID 174601590) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate.
| Compound Name | [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate |
|---|---|
| PubChem CID | 174601590 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | [(4R)-6-(2-aminophenyl)-6-imino-2,4-dimethylhexan-2-yl] carbamate |
| SMILES | [H]/N=C(\C[C@@H](C)CC(C)(C)OC(N)=O)c1ccccc1N |
| InChI | InChI=1S/C15H23N3O2/c1-10(9-15(2,3)20-14(18)19)8-13(17)11-6-4-5-7-12(11)16/h4-7,10,17H,8-9,16H2,1-3H3,(H2,18,19)/b17-13+/t10-/m1/s1 |
| InChIKey | OUSSNRLZXCDEJP-VFDYIDLISA-N |
| XLogP | 2.93 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|